(3-bromotricyclo[3.3.1.13,7]dec-1-yl)methanol structure
|
Common Name | (3-bromotricyclo[3.3.1.13,7]dec-1-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 36964-33-7 | Molecular Weight | 245.15600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-bromotricyclo[3.3.1.13,7]dec-1-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H17BrO |
|---|---|
| Molecular Weight | 245.15600 |
| Exact Mass | 244.04600 |
| PSA | 20.23000 |
| LogP | 2.71260 |
| InChIKey | JZJOEXRURZNLIA-UHFFFAOYSA-N |
| SMILES | OCC12CC3CC(CC(Br)(C3)C1)C2 |
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
| 1-bromo-3-hydroxymethyladamantane |
| (3-Brom-1-adamantyl)methanol |
| 1-Brom-3-hydroxymethyl-adamantan |
| (3-Brom-adamant-1-yl)-methanol |