meso-Tetrakis(4-chlorophenyl)porphyrin-Fe(III)chloride
meso-Tetrakis(4-chlorophenyl)porphyrin-Fe(III)chloride structure
|
Common Name | meso-Tetrakis(4-chlorophenyl)porphyrin-Fe(III)chloride | ||
|---|---|---|---|---|
| CAS Number | 36965-70-5 | Molecular Weight | 841.79800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H24Cl5FeN4 | Melting Point | ＞300℃ | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | ＞300℃ |
|---|---|
| Molecular Formula | C44H24Cl5FeN4 |
| Molecular Weight | 841.79800 |
| Exact Mass | 838.97900 |
| PSA | 19.72000 |
| LogP | 8.74540 |
| InChIKey | NHYPGHVTVBOYNQ-UHFFFAOYSA-K |
| SMILES | Cl[Fe](Cl)Cl.Clc1ccc(-c2c3nc(c(-c4ccc(Cl)cc4)c4ccc([nH]4)c(-c4ccc(Cl)cc4)c4nc(c(-c5ccc(Cl)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| chloro[meso-tetrakis(p-chlorophenyl)porphyrinato]iron(III) |
| 5,10,15,20-tetra(p-chlorophenyl)porphyrin iron(III) chloride |
| 5,10,15,20-tetrakis(p-chlorophenyl)porphyrin iron(III) chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl have? |
| A: English synonyms of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl: chloro[meso-tetrakis(p-chlorophenyl)porphyrinato]iron(III), 5,10,15,20-tetra(p-chlorophenyl)porphyrin iron(III) chloride, 5,10,15,20-tetrakis(p-chlorophenyl)porphyrin iron(III) chloride. |
| Q: What is the CAS number of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl? |
| A: CAS number of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl is 36965-70-5. |
| Q: What is the polar surface area (PSA) of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl? |
| A: Polar surface area (PSA) of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl is 19.72000. |
| Q: What is the molecular weight of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl? |
| A: Molecular weight of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl is 841.79800. |
| Q: What is the SMILES notation of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl? |
| A: SMILES notation of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl is Cl[Fe](Cl)Cl.Clc1ccc(-c2c3nc(c(-c4ccc(Cl)cc4)c4ccc([nH]4)c(-c4ccc(Cl)cc4)c4nc(c(-c5ccc(Cl)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1. |
| Q: What is the InChIKey of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl? |
| A: InChIKey of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl is NHYPGHVTVBOYNQ-UHFFFAOYSA-K. |
| Q: What is the melting point of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl? |
| A: Melting point of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl is ＞300℃. |
| Q: What is the molecular formula of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl? |
| A: Molecular formula of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl is C44H24Cl5FeN4. |
| Q: What is the LogP of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl? |
| A: LogP of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl is 8.74540. |
| Q: What is the English name of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl? |
| A: The English name of Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl is Fe(5,10,15,20-tetrakis(4-chlorophenyl)porphyrin)Cl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |