(1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol
Modify Date: 2025-12-27 02:03:08
(1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol structure
|
Common Name | (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 369651-18-3 | Molecular Weight | 210.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H26O |
|---|---|
| Molecular Weight | 210.36 |
| InChIKey | WCMAEEUFQIRPIB-ZOBORPQBSA-N |
| SMILES | C=CC(C)C1(O)CC(C)CCC1C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol? |
| A: Molecular formula of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol is C14H26O. |
| Q: What is the SMILES notation of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol? |
| A: SMILES notation of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol is C=CC(C)C1(O)CC(C)CCC1C(C)C. |
| Q: What is the English name of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol? |
| A: The English name of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol is (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol. |
| Q: What is the InChIKey of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol? |
| A: InChIKey of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol is WCMAEEUFQIRPIB-ZOBORPQBSA-N. |
| Q: What is the molecular weight of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol? |
| A: Molecular weight of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol is 210.36. |
| Q: What is the CAS number of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol? |
| A: CAS number of (1R,2S,5R)-1-((S)-But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol is 369651-18-3. |
| Q: What is the Chinese name of 369651-18-3? |
| A: Chinese name of 369651-18-3 is 369651-18-3. |