1,1'-Biphenyl-2,3,3',4'-tetracarboxylic acid
1,1'-Biphenyl-2,3,3',4'-tetracarboxylic acid structure
|
Common Name | 1,1'-Biphenyl-2,3,3',4'-tetracarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 36978-40-2 | Molecular Weight | 330.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Biphenyl-2,3,3',4-tetracarboxylic acid (1,1'-Biphenyl-2,3,3',4'-tetracarboxylic acid) with CAS number 36978-40-2, molecular formula C16H10O8, and molecular weight 330.24600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | biphenyl-2,3,3',4-tetracarboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H10O8 |
|---|---|
| Molecular Weight | 330.24600 |
| Exact Mass | 330.03800 |
| PSA | 149.20000 |
| LogP | 2.14640 |
| InChIKey | NBAUUNCGSMAPFM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2cccc(C(=O)O)c2C(=O)O)cc1C(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:36978-41-3
CAS#:2420-87-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3,3',4'-biphenyltetracarboxylic acid |
| 2,3,3',4'-Biphenyltetracarbonsaeure |
| a-BPTA |
| 2,3,3',4'-Biphenyl-tetracarbonsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does biphenyl-2,3,3',4-tetracarboxylic acid have? |
| A: English synonyms of biphenyl-2,3,3',4-tetracarboxylic acid: 2,3,3',4'-biphenyltetracarboxylic acid, 2,3,3',4'-Biphenyltetracarbonsaeure, a-BPTA, 2,3,3',4'-Biphenyl-tetracarbonsaeure. |
| Q: What is the molecular formula of biphenyl-2,3,3',4-tetracarboxylic acid? |
| A: Molecular formula of biphenyl-2,3,3',4-tetracarboxylic acid is C16H10O8. |
| Q: What is the English name of biphenyl-2,3,3',4-tetracarboxylic acid? |
| A: The English name of biphenyl-2,3,3',4-tetracarboxylic acid is biphenyl-2,3,3',4-tetracarboxylic acid. |
| Q: What is the LogP of biphenyl-2,3,3',4-tetracarboxylic acid? |
| A: LogP of biphenyl-2,3,3',4-tetracarboxylic acid is 2.14640. |
| Q: What is the CAS number of biphenyl-2,3,3',4-tetracarboxylic acid? |
| A: CAS number of biphenyl-2,3,3',4-tetracarboxylic acid is 36978-40-2. |
| Q: What are the downstream products of biphenyl-2,3,3',4-tetracarboxylic acid? |
| A: Related downstream products(CAS) of biphenyl-2,3,3',4-tetracarboxylic acid: 36978-41-3;2420-87-3. |
| Q: What is the polar surface area (PSA) of biphenyl-2,3,3',4-tetracarboxylic acid? |
| A: Polar surface area (PSA) of biphenyl-2,3,3',4-tetracarboxylic acid is 149.20000. |
| Q: What is the molecular weight of biphenyl-2,3,3',4-tetracarboxylic acid? |
| A: Molecular weight of biphenyl-2,3,3',4-tetracarboxylic acid is 330.24600. |
| Q: What is the SMILES notation of biphenyl-2,3,3',4-tetracarboxylic acid? |
| A: SMILES notation of biphenyl-2,3,3',4-tetracarboxylic acid is O=C(O)c1ccc(-c2cccc(C(=O)O)c2C(=O)O)cc1C(=O)O. |
| Q: What is the InChIKey of biphenyl-2,3,3',4-tetracarboxylic acid? |
| A: InChIKey of biphenyl-2,3,3',4-tetracarboxylic acid is NBAUUNCGSMAPFM-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |