3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide
Modify Date: 2025-11-06 15:42:06
3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide structure
|
Common Name | 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 36979-89-2 | Molecular Weight | 278.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13BrClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13BrClNO |
|---|---|
| Molecular Weight | 278.57 |
| InChIKey | TYFGYPVFEHBOBJ-UHFFFAOYSA-N |
| SMILES | Br.NC(Cc1ccccc1)C(=O)CCl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 36979-89-2? |
| A: Chinese name of 36979-89-2 is 36979-89-2. |
| Q: What is the CAS number of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide? |
| A: CAS number of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide is 36979-89-2. |
| Q: What is the molecular formula of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide? |
| A: Molecular formula of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide is C10H13BrClNO. |
| Q: What is the English name of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide? |
| A: The English name of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide is 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide. |
| Q: What is the InChIKey of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide? |
| A: InChIKey of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide is TYFGYPVFEHBOBJ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide? |
| A: Molecular weight of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide is 278.57. |
| Q: What is the SMILES notation of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide? |
| A: SMILES notation of 3-Amino-1-chloro-4-phenylbutan-2-one hydrobromide is Br.NC(Cc1ccccc1)C(=O)CCl. |