2-[(Dimethoxyphosphinothioyl)thio]butanedioic acid dipropyl ester
Modify Date: 2025-09-26 18:02:45
![2-[(Dimethoxyphosphinothioyl)thio]butanedioic acid dipropyl ester Structure](https://image.chemsrc.com/caspic/058/3700-91-2.png)
2-[(Dimethoxyphosphinothioyl)thio]butanedioic acid dipropyl ester structure
|
Common Name | 2-[(Dimethoxyphosphinothioyl)thio]butanedioic acid dipropyl ester | ||
|---|---|---|---|---|
| CAS Number | 3700-91-2 | Molecular Weight | 358.41100 | |
| Density | 1.224g/cm3 | Boiling Point | 413ºC at 760 mmHg | |
| Molecular Formula | C12H23O6PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.6ºC | |
| Name | dipropyl 2-dimethoxyphosphinothioylsulfanylbutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 413ºC at 760 mmHg |
| Molecular Formula | C12H23O6PS2 |
| Molecular Weight | 358.41100 |
| Flash Point | 203.6ºC |
| Exact Mass | 358.06700 |
| PSA | 138.26000 |
| LogP | 3.55260 |
| Index of Refraction | 1.504 |
| InChIKey | YBYPIDUKLGNEGL-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCCC |
| HS Code | 2931900090 |
|---|
|
~%
2-[(Dimethoxyph... CAS#:3700-91-2 |
| Literature: Am.Cyanamid Co. Patent: DE847897 , 1951 ; Full Text Show Details Am.Cyanamid Co. Patent: US2578652 , 1950 ; DRP/DRBP Org.Chem. |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphorodithioic acid,O,O-dimethyl ester,S-ester with 1,2-bis(propoxycarbonyl)ethanethiol |
| Carb-N-propoxy malathion |
| O,O-Dimethyl S-(1,2-dicarb-n-propoxy)ethyl phosphorodithioate |
| Dimethoxythiophosphorylmercapto-bernsteinsaeure-dipropylester |
| Phosphorodithioic acid,O,O-dimethyl S-(1,2-dipropoxycarbonyl)ethyl ester |
| dimethoxythiophosphorylsulfanyl-succinic acid dipropyl ester |
| S-(1,2-Di-n-propoxycarbonyl)ethyl O,O-dimethyl phosphorodithioate |