BENZOYL-D-PHE-OH structure
|
Common Name | BENZOYL-D-PHE-OH | ||
|---|---|---|---|---|
| CAS Number | 37002-52-1 | Molecular Weight | 269.295 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 532.0±43.0 °C at 760 mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.5±28.2 °C | |
| Name | (2R)-2-benzamido-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 532.0±43.0 °C at 760 mmHg |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.295 |
| Flash Point | 275.5±28.2 °C |
| Exact Mass | 269.105194 |
| PSA | 66.40000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | NPKISZUVEBESJI-CQSZACIVSA-N |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)c1ccccc1 |
| Storage condition | Store at 0°C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Hypoglycemic activity was determined as decrease in blood glucose at a dose 250 mg/kg...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL736178
|
| N-benzoyl-phenylalanine |
| Bz-DL-Phe-OH |
| N-benzoyl-DL-Phe |
| N-Benzoyl-D-phenylalanine |
| AmbotzBAA0033 |
| BENZOYL-D-PHE-OH |