7:2 Fluorotelomer dihydrogen phosphate
Modify Date: 2026-07-16 10:05:44
7:2 Fluorotelomer dihydrogen phosphate structure
|
Common Name | 7:2 Fluorotelomer dihydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 37013-72-2 | Molecular Weight | 494.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6F15O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7:2 Fluorotelomer dihydrogen phosphate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6F15O4P |
|---|---|
| Molecular Weight | 494.09 |
| InChIKey | XXKFVYRCSDPCBZ-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 7:2 Fluorotelomer dihydrogen phosphate? |
| A: SMILES notation of 7:2 Fluorotelomer dihydrogen phosphate is O=P(O)(O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the molecular formula of 7:2 Fluorotelomer dihydrogen phosphate? |
| A: Molecular formula of 7:2 Fluorotelomer dihydrogen phosphate is C9H6F15O4P. |
| Q: What is the InChIKey of 7:2 Fluorotelomer dihydrogen phosphate? |
| A: InChIKey of 7:2 Fluorotelomer dihydrogen phosphate is XXKFVYRCSDPCBZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 37013-72-2? |
| A: Chinese name of 37013-72-2 is 37013-72-2. |
| Q: What is the molecular weight of 7:2 Fluorotelomer dihydrogen phosphate? |
| A: Molecular weight of 7:2 Fluorotelomer dihydrogen phosphate is 494.09. |
| Q: What is the English name of 7:2 Fluorotelomer dihydrogen phosphate? |
| A: The English name of 7:2 Fluorotelomer dihydrogen phosphate is 7:2 Fluorotelomer dihydrogen phosphate. |
| Q: What is the CAS number of 7:2 Fluorotelomer dihydrogen phosphate? |
| A: CAS number of 7:2 Fluorotelomer dihydrogen phosphate is 37013-72-2. |