2-[[3-[(6-Chloro-2-methoxyacridin-9-yl)amino]propyl]amino]ethanol structure
|
Common Name | 2-[[3-[(6-Chloro-2-methoxyacridin-9-yl)amino]propyl]amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 37020-26-1 | Molecular Weight | 359.85000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[3-[(6-chloro-2-methoxyacridin-9-yl)amino]propylamino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H22ClN3O2 |
|---|---|
| Molecular Weight | 359.85000 |
| Exact Mass | 359.14000 |
| PSA | 69.64000 |
| LogP | 3.24670 |
| InChIKey | DNKBUJPNQWHIHC-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCCNCCO)c2c1 |
|
~%
2-[[3-[(6-Chlor... CAS#:37020-26-1 |
| Literature: Surrey et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 4102 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-({3-[(6-chloro-2-methoxyacridin-9-yl)amino]propyl}amino)ethanol |
| 2-[3-(6-Chlor-2-methoxy-acridin-9-ylamino)-propylamino]-aethanol |
| 2-<3-(2-Methoxy-6-chlor-9-acridinylamino)-propylamino>-ethanol |
| Ethanol,2-[[3-[(6-chloro-2-methoxy-9-acridinyl)amino]propyl]amino] |