1-(3,4,5-Trimethoxybenzoyl)piperidine
Modify Date: 2025-09-24 21:33:42
1-(3,4,5-Trimethoxybenzoyl)piperidine structure
|
Common Name | 1-(3,4,5-Trimethoxybenzoyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 3704-26-5 | Molecular Weight | 279.33200 | |
| Density | 1.133g/cm3 | Boiling Point | 444.4ºC at 760 mmHg | |
| Molecular Formula | C15H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.5ºC | |
| Name | piperidin-1-yl-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 444.4ºC at 760 mmHg |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.33200 |
| Flash Point | 222.5ºC |
| Exact Mass | 279.14700 |
| PSA | 48.00000 |
| LogP | 2.27640 |
| Index of Refraction | 1.531 |
| InChIKey | MDFLEQBDVHQKNX-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)N2CCCCC2)cc(OC)c1OC |
| HS Code | 2933399090 |
|---|
|
~32%
1-(3,4,5-Trimet... CAS#:3704-26-5 |
| Literature: Kar Pharmazie, 1983 , vol. 38, # 5 p. 313 - 315 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(3.4.5-Trimethoxy-benzoyl)-piperidin |
| 1-(3.4.5-Trimethoxy-benzoyl)-piperdin |
| Piperidine,1-(3,4,5-trimethoxybenzoyl) |
| 3,4,5-Trimethoxy-benzoesaeure-<piperidid> |
| N-(3,4,5-Trimethoxybenzoyl)piperidine |
| 1-(3,4,5-trimethoxy-benzoyl)-piperidine |