Benzenesulfonic acid,2-(2,4-dinitrophenyl)hydrazide structure
|
Common Name | Benzenesulfonic acid,2-(2,4-dinitrophenyl)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 37049-86-8 | Molecular Weight | 338.29600 | |
| Density | 1.602g/cm3 | Boiling Point | 523.5ºC at 760mmHg | |
| Molecular Formula | C12H10N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.4ºC | |
| Name | N'-(2,4-dinitrophenyl)benzenesulfonohydrazide |
|---|
| Density | 1.602g/cm3 |
|---|---|
| Boiling Point | 523.5ºC at 760mmHg |
| Molecular Formula | C12H10N4O6S |
| Molecular Weight | 338.29600 |
| Flash Point | 270.4ºC |
| Exact Mass | 338.03200 |
| PSA | 158.22000 |
| LogP | 4.39950 |
| Index of Refraction | 1.678 |
| InChIKey | VDBQTNYELDQHJH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NNS(=O)(=O)c2ccccc2)c([N+](=O)[O-])c1 |
|
~%
Benzenesulfonic... CAS#:37049-86-8 |
| Literature: McFadyen; Stevens Journal of the Chemical Society, 1936 , p. 584 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |