tert-butyl 3,5-dimethyl-1H-pyrrole-2-carboxylate structure
|
Common Name | tert-butyl 3,5-dimethyl-1H-pyrrole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 37059-15-7 | Molecular Weight | 195.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H17NO2 |
|---|---|
| Molecular Weight | 195.25800 |
| Exact Mass | 195.12600 |
| PSA | 42.09000 |
| LogP | 2.58680 |
| InChIKey | FWEMZCGPEMFKJT-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)OC(C)(C)C)[nH]1 |
| HS Code | 2933990090 |
|---|
|
~45%
tert-butyl 3,5-... CAS#:37059-15-7 |
| Literature: Smith, Kevin M.; Miura, Michiko; Tabba, Hani D. Journal of Organic Chemistry, 1983 , vol. 48, # 24 p. 4779 - 4781 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,5-dimethyl-pyrrole-2-carboxylic acid tert-butyl ester |
| 1H-Pyrrole-2-carboxylic acid,3,5-dimethyl-,1,1-dimethylethyl ester |