ethyl 3-(phenylcarbamoyloxy)benzoate
Modify Date: 2025-08-25 12:25:31
ethyl 3-(phenylcarbamoyloxy)benzoate structure
|
Common Name | ethyl 3-(phenylcarbamoyloxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 37070-83-0 | Molecular Weight | 285.29500 | |
| Density | 1.246g/cm3 | Boiling Point | 407.4ºC at 760 mmHg | |
| Molecular Formula | C16H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.2ºC | |
| Name | ethyl 3-(phenylcarbamoyloxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 407.4ºC at 760 mmHg |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.29500 |
| Flash Point | 200.2ºC |
| Exact Mass | 285.10000 |
| PSA | 68.12000 |
| LogP | 3.48780 |
| Index of Refraction | 1.602 |
| InChIKey | VRFMTHVIAOXFIY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccc(OC(=O)Nc2ccccc2)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl 3-(((phenylamino)carbonyl)oxy)benzoate |