tri-O-acetyl-5-deoxy-D-ribofuranose structure
|
Common Name | tri-O-acetyl-5-deoxy-D-ribofuranose | ||
|---|---|---|---|---|
| CAS Number | 37076-71-4 | Molecular Weight | 260.24100 | |
| Density | 1.23g/cm3 | Boiling Point | 315.3ºC at 760mmHg | |
| Molecular Formula | C11H16O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.7ºC | |
| Name | (3R,4R,5R)-5-Methyltetrahydrofuran-2,3,4-triyl triacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 315.3ºC at 760mmHg |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24100 |
| Flash Point | 135.7ºC |
| Exact Mass | 260.09000 |
| PSA | 88.13000 |
| LogP | 0.15770 |
| Index of Refraction | 1.465 |
| InChIKey | NXEJETQVUQAKTO-ZBCCYFLUSA-N |
| SMILES | CC(=O)OC1OC(C)C(OC(C)=O)C1OC(C)=O |
| HS Code | 2932190090 |
|---|
| Precursor 6 | |
|---|---|
| DownStream 5 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1,2,3-Tri-O-acetyl-5-deoxy-D-ribofuranose |
| 5-deoxy-D-ribose-1,2,3-tri-O-acetate |
| 5-deoxy-1,2,3-tri-O-acetyl-D-ribofuranose |
| 1,2,3-Tri-O-acetyl-5-deoxyribofuranose |
| 5-Deoxy-D-ribofuranose triacetate |
| 5-desoxy-1,2,3-tri-O-acetyl-D-ribofuranose |
| 5'-deoxyribofuranose 1,2,3-triacetate |
| tri-O-acetyl-5-deoxy-D-ribofuranose |