(4-formylphenyl) N-phenylcarbamate
Modify Date: 2025-12-14 12:05:38
(4-formylphenyl) N-phenylcarbamate structure
|
Common Name | (4-formylphenyl) N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 37076-88-3 | Molecular Weight | 241.24200 | |
| Density | 1.296g/cm3 | Boiling Point | 383.9ºC at 760 mmHg | |
| Molecular Formula | C14H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186ºC | |
| Name | (4-formylphenyl) N-phenylcarbamate |
|---|
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 383.9ºC at 760 mmHg |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.24200 |
| Flash Point | 186ºC |
| Exact Mass | 241.07400 |
| PSA | 55.40000 |
| LogP | 3.18300 |
| Index of Refraction | 1.662 |
| InChIKey | BPFODGWHRDEZIG-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(OC(=O)Nc2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |