1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pent-2-ene structure
|
Common Name | 1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pent-2-ene | ||
|---|---|---|---|---|
| CAS Number | 3709-70-4 | Molecular Weight | 300.04500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6F12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)pent-2-ene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6F12 |
|---|---|
| Molecular Weight | 300.04500 |
| Exact Mass | 299.98100 |
| LogP | 4.53220 |
| InChIKey | SAPOZTRFWJZUFT-UPHRSURJSA-N |
| SMILES | FC(=C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
|
~%
1,1,1,2,3,4,5,5... CAS#:3709-70-4
Detail
|
| Literature: Dresdner,R.D. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 3524 - 3527 |
|
~%
1,1,1,2,3,4,5,5... CAS#:3709-70-4 |
| Literature: Martini,T.; von Halasz,S.P. Tetrahedron Letters, 1974 , p. 2129 - 2132 |
|
~%
1,1,1,2,3,4,5,5... CAS#:3709-70-4 |
| Literature: Dresdner,R.D. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 3524 - 3527 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Pentene,1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)-,(Z) |
| (Z)-1,1,1,2,3,4,5,5,5-nonafluoro-4-trifluoromethyl-pent-2-ene |
| cis-Perfluoro-4-methyl-2-penten |
| 1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)-2-pentene |
| perfluoro-Z-(4-methyl-2-pentene) |
| perfluoro-Z-4-methylpent-2-ene |
| 1,1,1,2,3,4,5,5,5-nonakis(fluoranyl)-4-(trifluoromethyl)pent-2-ene |
| cis-Perfluor-2-methyl-3-penten |
| Perfluor(4-methyl-cis-2-penten) |
| 2-Pentene,1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl) |
| cis-1,1,1,2,3,4,5,5,5--nonafluoro-4-trifluoromethylpent-2-ene |