4-(1,3-dioxo-2-benzofuran-4-yl)-2-benzofuran-1,3-dione structure
|
Common Name | 4-(1,3-dioxo-2-benzofuran-4-yl)-2-benzofuran-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 3711-04-4 | Molecular Weight | 294.21500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(1,3-dioxo-2-benzofuran-4-yl)-2-benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H6O6 |
|---|---|
| Molecular Weight | 294.21500 |
| Exact Mass | 294.01600 |
| PSA | 86.74000 |
| LogP | 1.97480 |
| InChIKey | ZQUUGNBTODQIDG-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2c1cccc2-c1cccc2c1C(=O)OC2=O |
| HS Code | 2932999099 |
|---|
|
~%
4-(1,3-dioxo-2-... CAS#:3711-04-4 |
| Literature: Kenner; Mathews Journal of the Chemical Society, 1914 , vol. 105, p. 2480 |
|
~%
4-(1,3-dioxo-2-... CAS#:3711-04-4 |
| Literature: Kenner; Mathews Journal of the Chemical Society, 1914 , vol. 105, p. 2480 |
|
~%
4-(1,3-dioxo-2-... CAS#:3711-04-4 |
| Literature: Kenner; Mathews Journal of the Chemical Society, 1914 , vol. 105, p. 2480 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,5'-Bis[isobenzofurane-1,3(1H,3H)-dione] |
| 3,3'-Biphenyltetracarboxylic acid,2,3:2',3'-dianhydride |
| 2,2' |
| [4,4'-Biisobenzofuran]-1,1',3,3'-tetrone |
| biphenyl-2,3,2',3'-tetracarboxylic acid-2,3,2',3'-dianhydride |
| Biphenyl-2,3,2',3'-tetracarbonsaeure-2,3,2',3'-dianhydrid |
| 2,3,2',3'-biphenyltetracarboxylic dianhydride |