10-hydroxy-1H-benzo[g]quinoline-5,6,9-trione structure
|
Common Name | 10-hydroxy-1H-benzo[g]quinoline-5,6,9-trione | ||
|---|---|---|---|---|
| CAS Number | 3712-11-6 | Molecular Weight | 241.19900 | |
| Density | 1.61g/cm3 | Boiling Point | 406.8ºC at 760 mmHg | |
| Molecular Formula | C13H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.8ºC | |
| Name | 10-hydroxy-1H-benzo[g]quinoline-5,6,9-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 406.8ºC at 760 mmHg |
| Molecular Formula | C13H7NO4 |
| Molecular Weight | 241.19900 |
| Flash Point | 199.8ºC |
| Exact Mass | 241.03800 |
| PSA | 87.49000 |
| LogP | 1.26820 |
| Index of Refraction | 1.738 |
| InChIKey | AFDMGIUNNDWCBX-UHFFFAOYSA-N |
| SMILES | O=C1c2cccnc2C(=O)c2c(O)ccc(O)c21 |
|
~20%
10-hydroxy-1H-b... CAS#:3712-11-6 |
| Literature: Krapcho; Landi Jr.; Hacker; McCormack Journal of Medicinal Chemistry, 1985 , vol. 28, # 8 p. 1124 - 1126 |
|
~%
10-hydroxy-1H-b... CAS#:3712-11-6 |
| Literature: BOEHRINGER MANNHEIM ITALIA S.P.A. Patent: EP639183 B1, 1998 ; |
|
~%
10-hydroxy-1H-b... CAS#:3712-11-6 |
| Literature: Raudnitz Chemische Berichte, 1929 , vol. 62, p. 512 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6,9-Dihydroxy-5,10-dioxo-5,10-dihydro-benzo<g>chinolin |
| 6,9-dihydroxybenzo[g]quinoline-5,10-dione |
| 6,9-Dihydroxy-benzo[g]chinolin-5,10-dion |
| 6,9-Dihydroxy-benzo<g>chinolin-chinon-(5,10) |
| 6,9-dihydroxybenzo<g>quinoline-5,10-quinone |