D-glucose phenylhydrazone structure
|
Common Name | D-glucose phenylhydrazone | ||
|---|---|---|---|---|
| CAS Number | 3713-25-5 | Molecular Weight | 270.28200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | D-glucose phenylhydrazone |
|---|
| Molecular Formula | C12H18N2O5 |
|---|---|
| Molecular Weight | 270.28200 |
| Exact Mass | 270.12200 |
| PSA | 125.54000 |
| InChIKey | MAKRUZFBMOBWLJ-IRCOFANPSA-N |
| SMILES | OCC(O)C(O)C(O)C(O)C=NNc1ccccc1 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |