1-(4-amino-3-bromo-5-chlorophenyl)-2-(tert-butylamino)ethanol
Modify Date: 2025-08-20 18:05:06
1-(4-amino-3-bromo-5-chlorophenyl)-2-(tert-butylamino)ethanol structure
|
Common Name | 1-(4-amino-3-bromo-5-chlorophenyl)-2-(tert-butylamino)ethanol | ||
|---|---|---|---|---|
| CAS Number | 37153-52-9 | Molecular Weight | 321.64100 | |
| Density | 1.424g/cm3 | Boiling Point | 430.3ºC at 760mmHg | |
| Molecular Formula | C12H18BrClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214ºC | |
| Name | 1-(4-amino-3-bromo-5-chlorophenyl)-2-(tert-butylamino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 430.3ºC at 760mmHg |
| Molecular Formula | C12H18BrClN2O |
| Molecular Weight | 321.64100 |
| Flash Point | 214ºC |
| Exact Mass | 320.02900 |
| PSA | 58.28000 |
| LogP | 4.07830 |
| Index of Refraction | 1.59 |
| InChIKey | RBROAKIHDILEQG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Br)c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Bromoclenbuterol |