1,2-dichloropropane,(E)-1,3-dichloroprop-1-ene,trichloro(nitro)methane
Modify Date: 2025-10-01 02:11:06
1,2-dichloropropane,(E)-1,3-dichloroprop-1-ene,trichloro(nitro)methane structure
|
Common Name | 1,2-dichloropropane,(E)-1,3-dichloroprop-1-ene,trichloro(nitro)methane | ||
|---|---|---|---|---|
| CAS Number | 37287-23-3 | Molecular Weight | 388.33100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10Cl7NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-dichloropropane,(E)-1,3-dichloroprop-1-ene,trichloro(nitro)methane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H10Cl7NO2 |
|---|---|
| Molecular Weight | 388.33100 |
| Exact Mass | 384.85300 |
| PSA | 45.82000 |
| LogP | 5.94420 |
| InChIKey | CDOLMMIFVNQNIV-JITBQSAISA-N |
| SMILES | CC(Cl)CCl.ClC=CCCl.O=[N+]([O-])C(Cl)(Cl)Cl |
| 1-Propene,1,3-dichloro-,mixt. with 1,2-dichloropropane and trichloronitromethane |
| 1,3-Dichloro-1-propene,mixt. with 1,2-dichloropropane and trichloronitromethane |