ethyl 3-(1-methyl-4-nitropyrrol-2-yl)prop-2-enoate structure
|
Common Name | ethyl 3-(1-methyl-4-nitropyrrol-2-yl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 373362-02-8 | Molecular Weight | 224.21300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-(1-methyl-4-nitropyrrol-2-yl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12N2O4 |
|---|---|
| Molecular Weight | 224.21300 |
| Exact Mass | 224.08000 |
| PSA | 77.05000 |
| LogP | 2.03280 |
| InChIKey | QJMZEVRTTTWUPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=Cc1cc([N+](=O)[O-])cn1C |
|
~%
ethyl 3-(1-meth... CAS#:373362-02-8 |
| Literature: Bando, Toshikazu; Narita, Akihiko; Saito, Isao; Sugiyama, Hiroshi Journal of the American Chemical Society, 2003 , vol. 125, # 12 p. 3471 - 3485 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Propenoic acid,3-(1-methyl-4-nitro-1H-pyrrol-2-yl)-,ethyl ester,(2E) |