4-diethoxyphosphinothioyloxyaniline structure
|
Common Name | 4-diethoxyphosphinothioyloxyaniline | ||
|---|---|---|---|---|
| CAS Number | 3735-01-1 | Molecular Weight | 261.27800 | |
| Density | 1.244g/cm3 | Boiling Point | 346.2ºC at 760 mmHg | |
| Molecular Formula | C10H16NO3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.2ºC | |
| Name | 4-diethoxyphosphinothioyloxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 346.2ºC at 760 mmHg |
| Molecular Formula | C10H16NO3PS |
| Molecular Weight | 261.27800 |
| Flash Point | 163.2ºC |
| Exact Mass | 261.05900 |
| PSA | 95.61000 |
| LogP | 4.17690 |
| Index of Refraction | 1.567 |
| InChIKey | XIZOTXGJXSTQDI-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)Oc1ccc(N)cc1 |
| HS Code | 2922199090 |
|---|
|
~69%
4-diethoxyphosp... CAS#:3735-01-1 |
| Literature: Rung, Bruno; Schwack, Wolfgang Journal of Agricultural and Food Chemistry, 2005 , vol. 53, # 23 p. 9140 - 9145 |
|
~%
4-diethoxyphosp... CAS#:3735-01-1 |
| Literature: Tang, Jian She; Xiang, Li Chinese Chemical Letters, 2010 , vol. 21, # 11 p. 1361 - 1365 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| O,O-diethyl O-(4-aminophenyl) thiophosphate |
| Aminoparathion |
| O,O-Diethyl O-(4-aminophenyl) phosphorothioate |
| O-(p-aminophenyl) O,O-diethyl phosphorothioate |
| O-(4-AMINOPHENYL) O,O-DIETHYL PHOSPHOROTHIOATE |
| p-Aminoparathion |
| Phosphorothioic acid,O-(4-aminophenyl) O,O-diethyl ester |
| E 605 reduced |