benzhydrylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane
Modify Date: 2025-11-30 18:13:27
benzhydrylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane structure
|
Common Name | benzhydrylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 3735-04-4 | Molecular Weight | 352.45100 | |
| Density | 1.197g/cm3 | Boiling Point | 430.6ºC at 760 mmHg | |
| Molecular Formula | C17H21O2PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | benzhydrylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 430.6ºC at 760 mmHg |
| Molecular Formula | C17H21O2PS2 |
| Molecular Weight | 352.45100 |
| Flash Point | 214.2ºC |
| Exact Mass | 352.07200 |
| PSA | 85.66000 |
| LogP | 6.45730 |
| Index of Refraction | 1.592 |
| InChIKey | RSFHNQRYJIIZIN-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SC(c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| benzhydrylsulfanyl-diethoxy-sulfanylidene |
| S-(Diphenylmethyl) O,O-diethyl phosphorodithioate |
| Phosphorodithioic acid,S-(diphenylmethyl) O,O-diethyl ester |