Dmophebumine structure
|
Common Name | Dmophebumine | ||
|---|---|---|---|---|
| CAS Number | 3735-45-3 | Molecular Weight | 313.43400 | |
| Density | 1.027g/cm3 | Boiling Point | 421.7ºC at 760mmHg | |
| Molecular Formula | C20H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.1ºC | |
| Name | 1-(3,4-dimethoxyphenyl)-N,N-dimethyl-4-phenylbutan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.027g/cm3 |
|---|---|
| Boiling Point | 421.7ºC at 760mmHg |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.43400 |
| Flash Point | 127.1ºC |
| Exact Mass | 313.20400 |
| PSA | 21.70000 |
| LogP | 4.32940 |
| Index of Refraction | 1.541 |
| InChIKey | HEFVRVOEBZDOJU-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(CCCc2ccccc2)N(C)C)cc1OC |
| HS Code | 2922299090 |
|---|
|
~%
Dmophebumine CAS#:3735-45-3 |
| Literature: Seeger, Kottler Patent: US3133967 , 1964 ; Chem.Abstr., 1964 , vol. 61, # 9436 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| [1-(3,4-dimethoxy-phenyl)-4-phenyl-butyl]-dimethyl-amine |
| Refatrin |
| 1-(3,4-Dimethoxyphenyl)-1-dimethylamino-4-phenyl-butan |
| Monzal |
| Vetrabutine |
| UNII-I3E2J32F37 |
| Vetrabutine (INN) |
| Monzaldon |
| Monzal (TN) |