Carbanilic acid, m-chloro-, 2-(dimethylamino)ethyl ester (6CI,7CI,8CI) structure
|
Common Name | Carbanilic acid, m-chloro-, 2-(dimethylamino)ethyl ester (6CI,7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 3738-99-6 | Molecular Weight | 242.70200 | |
| Density | 1.228g/cm3 | Boiling Point | 292ºC at 760 mmHg | |
| Molecular Formula | C11H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.4ºC | |
| Name | 2-(dimethylamino)ethyl N-(3-chlorophenyl)carbamate |
|---|
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 292ºC at 760 mmHg |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.70200 |
| Flash Point | 130.4ºC |
| Exact Mass | 242.08200 |
| PSA | 41.57000 |
| LogP | 2.52310 |
| Index of Refraction | 1.569 |
| InChIKey | YJLHVRZBNUAMKT-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC(=O)Nc1cccc(Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~%
Carbanilic acid... CAS#:3738-99-6 |
| Literature: Epstein; Kaminsky Journal of the American Pharmaceutical Association (1912-1977), 1958 , vol. 47, p. 347 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |