1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol
![1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol Structure](https://image.chemsrc.com/caspic/300/37394-26-6.png)
1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol structure
|
Common Name | 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 37394-26-6 | Molecular Weight | 210.27000 | |
| Density | 1.151g/cm3 | Boiling Point | 351.3ºC at 760 mmHg | |
| Molecular Formula | C12H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.8ºC | |
Summary: 1-[3,5-Bis(1-hydroxyethyl)phenyl]ethanol, also known as 3,5-Bis(1-hydroxyethyl)phenylethanol, with CAS number 37394-26-6, has a molecular formula of C12H18O3 and a molecular weight of 210.27000. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 351.3ºC at 760 mmHg |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27000 |
| Flash Point | 166.8ºC |
| Exact Mass | 210.12600 |
| PSA | 60.69000 |
| LogP | 1.84650 |
| Index of Refraction | 1.565 |
| InChIKey | UAHZWJCHJDIXSX-UHFFFAOYSA-N |
| SMILES | CC(O)c1cc(C(C)O)cc(C(C)O)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:3048-52-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3,5-Tris-(1-hydroxy-aethyl)-benzol |
| 1,3,5-tris-(1-hydroxy-ethyl)-benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol? |
| A: Related downstream products(CAS) of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol: 3048-52-0. |
| Q: What is the Chinese name of 37394-26-6? |
| A: Chinese name of 37394-26-6 is 37394-26-6. |
| Q: What is the LogP of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol? |
| A: LogP of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol is 1.84650. |
| Q: What is the polar surface area (PSA) of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol? |
| A: Polar surface area (PSA) of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol is 60.69000. |
| Q: What is the SMILES notation of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol? |
| A: SMILES notation of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol is CC(O)c1cc(C(C)O)cc(C(C)O)c1. |
| Q: What is the InChIKey of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol? |
| A: InChIKey of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol is UAHZWJCHJDIXSX-UHFFFAOYSA-N. |
| Q: What is the English name of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol? |
| A: The English name of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol is 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol. |
| Q: What is the molecular weight of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol? |
| A: Molecular weight of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol is 210.27000. |
| Q: What English synonyms does 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol have? |
| A: English synonyms of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol: 1,3,5-Tris-(1-hydroxy-aethyl)-benzol, 1,3,5-tris-(1-hydroxy-ethyl)-benzene. |
| Q: What is the CAS number of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol? |
| A: CAS number of 1-[3,5-bis(1-hydroxyethyl)phenyl]ethanol is 37394-26-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |