4-chloro-1,1,1,2,2,3,3-heptafluorobutane
Modify Date: 2025-09-27 22:27:28
4-chloro-1,1,1,2,2,3,3-heptafluorobutane structure
|
Common Name | 4-chloro-1,1,1,2,2,3,3-heptafluorobutane | ||
|---|---|---|---|---|
| CAS Number | 374-97-0 | Molecular Weight | 218.50100 | |
| Density | 1.514g/cm3 | Boiling Point | 53.8ºC at 760 mmHg | |
| Molecular Formula | C4H2ClF7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-1,1,1,2,2,3,3-heptafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.514g/cm3 |
|---|---|
| Boiling Point | 53.8ºC at 760 mmHg |
| Molecular Formula | C4H2ClF7 |
| Molecular Weight | 218.50100 |
| Exact Mass | 217.97300 |
| LogP | 3.05810 |
| Index of Refraction | 1.294 |
| InChIKey | SZBKCQKJQAYJJN-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)CCl |
|
~%
4-chloro-1,1,1,... CAS#:374-97-0 |
| Literature: Tiers et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 5978 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-chloro-1H,1H-heptafluoro-butane |
| 1,1,1,2,2,3,3-Heptafluoro-4-chlorobutane |
| 1-Chlor-1H,1H-heptafluor-butan |
| 4-chloro-1,1,1,2,2,3,3-heptafluoro-butane |
| 1,1,1,2,2,3,3-Heptafluor-4-chlor-butan |