2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid
Modify Date: 2025-10-03 00:11:49
![2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid Structure](https://www.chemsrc.com/extcaspic/337/37409-41-9.png)
2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid structure
|
Common Name | 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 37409-41-9 | Molecular Weight | 420.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H16N2O4 |
|---|---|
| Molecular Weight | 420.4 |
| InChIKey | VYCRZDPZGXUPAQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccc2)nc2cc3nc(-c4ccccc4)cc(C(=O)O)c3cc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid? |
| A: CAS number of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid is 37409-41-9. |
| Q: What is the molecular formula of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid? |
| A: Molecular formula of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid is C26H16N2O4. |
| Q: What is the SMILES notation of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid? |
| A: SMILES notation of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid is O=C(O)c1cc(-c2ccccc2)nc2cc3nc(-c4ccccc4)cc(C(=O)O)c3cc12. |
| Q: What is the molecular weight of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid? |
| A: Molecular weight of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid is 420.4. |
| Q: What is the Chinese name of 37409-41-9? |
| A: Chinese name of 37409-41-9 is 37409-41-9. |
| Q: What is the English name of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid? |
| A: The English name of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid is 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid. |
| Q: What is the InChIKey of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid? |
| A: InChIKey of 2,8-Diphenylpyrido[3,2-g]quinoline-4,6-dicarboxylic acid is VYCRZDPZGXUPAQ-UHFFFAOYSA-N. |