N-Acetyl-4-methoxymetanilyl chloride structure
|
Common Name | N-Acetyl-4-methoxymetanilyl chloride | ||
|---|---|---|---|---|
| CAS Number | 3746-67-6 | Molecular Weight | 263.69800 | |
| Density | 1.439g/cm3 | Boiling Point | 448.6ºC at 760mmHg | |
| Molecular Formula | C9H10ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | 3-Acetamido-4-methoxybenzene-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 448.6ºC at 760mmHg |
| Molecular Formula | C9H10ClNO4S |
| Molecular Weight | 263.69800 |
| Flash Point | 225.1ºC |
| Exact Mass | 263.00200 |
| PSA | 80.85000 |
| LogP | 2.73490 |
| Index of Refraction | 1.566 |
| InChIKey | KRKMAUKQDRAOFI-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)Cl)cc1NC(C)=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-acetamido-4-methoxybenzenesulfonyl chloride |