VEC-5 structure
|
Common Name | VEC-5 | ||
|---|---|---|---|---|
| CAS Number | 374679-27-3 | Molecular Weight | 447.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of VEC-5VEC-5 is a HIV-1 inhibitor. VEC5 have been evaluated for their inhibitory potential employing ligand receptor and protein-protein interactions studies. VEC-5 exhibited better interaction with Vif than RN18. |
| Name | VEC-5 |
|---|
| Description | VEC-5 is a HIV-1 inhibitor. VEC5 have been evaluated for their inhibitory potential employing ligand receptor and protein-protein interactions studies. VEC-5 exhibited better interaction with Vif than RN18. |
|---|---|
| References | 1. Sinha C, Nischal A, Bandaru S, Kasera P, Rajput A, Nayarisseri A, Khattri S. An in silico approach for identification of novel inhibitors as a potential therapeutics targeting HIV-1 viral infectivity factor. Curr Top Med Chem. 2015;15(1):65-72. PubMed PMID: 25579575. |
| Molecular Formula | C29H21NO4 |
|---|---|
| Molecular Weight | 447.48 |
| InChIKey | OMNFLCJXENKOCL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C(=O)c2ccc3ccccc3c2)n2ccc(C(=O)c3ccccc3)cc12 |