ethyl 3-[(2-ethoxycarbonyl-2-methyl-propyl)-tert-butyl-amino]-2,2-dimethyl-propanoate structure
|
Common Name | ethyl 3-[(2-ethoxycarbonyl-2-methyl-propyl)-tert-butyl-amino]-2,2-dimethyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 37489-09-1 | Molecular Weight | 329.47500 | |
| Density | 0.968g/cm3 | Boiling Point | 377.6ºC at 760 mmHg | |
| Molecular Formula | C18H35NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.2ºC | |
| Name | ethyl 3-[tert-butyl-(3-ethoxy-2,2-dimethyl-3-oxopropyl)amino]-2,2-dimethylpropanoate |
|---|
| Density | 0.968g/cm3 |
|---|---|
| Boiling Point | 377.6ºC at 760 mmHg |
| Molecular Formula | C18H35NO4 |
| Molecular Weight | 329.47500 |
| Flash Point | 182.2ºC |
| Exact Mass | 329.25700 |
| PSA | 55.84000 |
| LogP | 3.26550 |
| Index of Refraction | 1.457 |
| InChIKey | XSWAJINSDAXRMI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)CN(CC(C)(C)C(=O)OCC)C(C)(C)C |
|
~%
ethyl 3-[(2-eth... CAS#:37489-09-1 |
| Literature: Johnson,P.Y. et al. Journal of Organic Chemistry, 1975 , vol. 40, p. 2710 - 2720 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |