1-Chloro-F-pentane
Modify Date: 2025-07-05 16:32:26
1-Chloro-F-pentane structure
|
Common Name | 1-Chloro-F-pentane | ||
|---|---|---|---|---|
| CAS Number | 375-71-3 | Molecular Weight | 304.48900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5ClF11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Chloro-F-pentane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5ClF11 |
|---|---|
| Molecular Weight | 304.48900 |
| Exact Mass | 303.95100 |
| LogP | 4.28620 |
| InChIKey | TWPDOWXLJAQWJW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-chloro-1H-undecafluoro-pentane |
| 1-chloro-undecafluoro-pentane |
| 1-Chlor-undecafluor-pentan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-Chloro-F-pentane? |
| A: InChIKey of 1-Chloro-F-pentane is TWPDOWXLJAQWJW-UHFFFAOYSA-N. |
| Q: What English synonyms does 1-Chloro-F-pentane have? |
| A: English synonyms of 1-Chloro-F-pentane: 1-chloro-1H-undecafluoro-pentane, 1-chloro-undecafluoro-pentane, 1-Chlor-undecafluor-pentan. |
| Q: What is the Chinese name of 375-71-3? |
| A: Chinese name of 375-71-3 is 375-71-3. |
| Q: What is the SMILES notation of 1-Chloro-F-pentane? |
| A: SMILES notation of 1-Chloro-F-pentane is FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl. |
| Q: What is the English name of 1-Chloro-F-pentane? |
| A: The English name of 1-Chloro-F-pentane is 1-Chloro-F-pentane. |
| Q: What is the molecular weight of 1-Chloro-F-pentane? |
| A: Molecular weight of 1-Chloro-F-pentane is 304.48900. |
| Q: What is the LogP of 1-Chloro-F-pentane? |
| A: LogP of 1-Chloro-F-pentane is 4.28620. |
| Q: What is the CAS number of 1-Chloro-F-pentane? |
| A: CAS number of 1-Chloro-F-pentane is 375-71-3. |
| Q: What is the molecular formula of 1-Chloro-F-pentane? |
| A: Molecular formula of 1-Chloro-F-pentane is C5ClF11. |