1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane
1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane structure
|
Common Name | 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane | ||
|---|---|---|---|---|
| CAS Number | 375-79-1 | Molecular Weight | 511.76600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6Cl4F9I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6Cl4F9I |
|---|---|
| Molecular Weight | 511.76600 |
| Exact Mass | 509.76600 |
| LogP | 6.19490 |
| InChIKey | CLOXRHRGPHJOCG-UHFFFAOYSA-N |
| SMILES | FC(F)(Cl)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)I |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:307-26-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2,4,6-Tetrachlor-nonafluor-6-jod-hexan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane? |
| A: The English name of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane is 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane. |
| Q: What English synonyms does 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane have? |
| A: English synonyms of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane: 1,2,4,6-Tetrachlor-nonafluor-6-jod-hexan. |
| Q: What is the molecular weight of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane? |
| A: Molecular weight of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane is 511.76600. |
| Q: What are the downstream products of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane? |
| A: Related downstream products(CAS) of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane: 307-26-6. |
| Q: What is the InChIKey of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane? |
| A: InChIKey of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane is CLOXRHRGPHJOCG-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane? |
| A: CAS number of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane is 375-79-1. |
| Q: What is the LogP of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane? |
| A: LogP of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane is 6.19490. |
| Q: What is the Chinese name of 375-79-1? |
| A: Chinese name of 375-79-1 is 375-79-1. |
| Q: What is the SMILES notation of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane? |
| A: SMILES notation of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane is FC(F)(Cl)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)I. |
| Q: What is the molecular formula of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane? |
| A: Molecular formula of 1,2,4,6-tetrachloro-nonafluoro-6-iodo-hexane is C6Cl4F9I. |