1,1-di-(perfluoro n-propyl) ethanol-(1)
Modify Date: 2025-08-26 10:49:52
1,1-di-(perfluoro n-propyl) ethanol-(1) structure
|
Common Name | 1,1-di-(perfluoro n-propyl) ethanol-(1) | ||
|---|---|---|---|---|
| CAS Number | 375-86-0 | Molecular Weight | 382.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4F14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1-di-(perfluoro n-propyl) ethanol-(1) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H4F14O |
|---|---|
| Molecular Weight | 382.09400 |
| Exact Mass | 382.00400 |
| PSA | 20.23000 |
| LogP | 4.40320 |
| InChIKey | HVSVHSIBXMEXNI-UHFFFAOYSA-N |
| SMILES | CC(O)(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1-di-(Perfluor-n-propyl)-ethanol-(1) |
| Tetradecafluor-4-methyl-heptan-4-ol |
| tetradecafluoro-4-methyl-heptan-4-ol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1,1-di-(perfluoro n-propyl) ethanol-(1)? |
| A: Polar surface area (PSA) of 1,1-di-(perfluoro n-propyl) ethanol-(1) is 20.23000. |
| Q: What is the CAS number of 1,1-di-(perfluoro n-propyl) ethanol-(1)? |
| A: CAS number of 1,1-di-(perfluoro n-propyl) ethanol-(1) is 375-86-0. |
| Q: What is the LogP of 1,1-di-(perfluoro n-propyl) ethanol-(1)? |
| A: LogP of 1,1-di-(perfluoro n-propyl) ethanol-(1) is 4.40320. |
| Q: What English synonyms does 1,1-di-(perfluoro n-propyl) ethanol-(1) have? |
| A: English synonyms of 1,1-di-(perfluoro n-propyl) ethanol-(1): 1,1-di-(Perfluor-n-propyl)-ethanol-(1), Tetradecafluor-4-methyl-heptan-4-ol, tetradecafluoro-4-methyl-heptan-4-ol. |
| Q: What is the molecular formula of 1,1-di-(perfluoro n-propyl) ethanol-(1)? |
| A: Molecular formula of 1,1-di-(perfluoro n-propyl) ethanol-(1) is C8H4F14O. |
| Q: What is the InChIKey of 1,1-di-(perfluoro n-propyl) ethanol-(1)? |
| A: InChIKey of 1,1-di-(perfluoro n-propyl) ethanol-(1) is HVSVHSIBXMEXNI-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,1-di-(perfluoro n-propyl) ethanol-(1)? |
| A: SMILES notation of 1,1-di-(perfluoro n-propyl) ethanol-(1) is CC(O)(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the molecular weight of 1,1-di-(perfluoro n-propyl) ethanol-(1)? |
| A: Molecular weight of 1,1-di-(perfluoro n-propyl) ethanol-(1) is 382.09400. |
| Q: What is the Chinese name of 375-86-0? |
| A: Chinese name of 375-86-0 is 375-86-0. |
| Q: What is the English name of 1,1-di-(perfluoro n-propyl) ethanol-(1)? |
| A: The English name of 1,1-di-(perfluoro n-propyl) ethanol-(1) is 1,1-di-(perfluoro n-propyl) ethanol-(1). |