1-Chloroperfluoroheptane
Modify Date: 2026-08-14 06:39:22
1-Chloroperfluoroheptane structure
|
Common Name | 1-Chloroperfluoroheptane | ||
|---|---|---|---|---|
| CAS Number | 375-89-3 | Molecular Weight | 404.50400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7ClF15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Chloroperfluoroheptane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7ClF15 |
|---|---|
| Molecular Weight | 404.50400 |
| Exact Mass | 403.94500 |
| LogP | 5.55680 |
| InChIKey | MAUNZEOOXXBGIT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Chlor-pentadecafluor-heptan |
| 1-chloro-1H-pentadecafluoro-heptane |
| 1-Chlor-perfluorheptan |
| 1-chloro-pentadecafluoro-heptane |
| 1-chloroperfluoroheptane |
| Chlor-perfluor-heptan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 375-89-3? |
| A: Chinese name of 375-89-3 is 375-89-3. |
| Q: What English synonyms does 1-Chloroperfluoroheptane have? |
| A: English synonyms of 1-Chloroperfluoroheptane: 1-Chlor-pentadecafluor-heptan, 1-chloro-1H-pentadecafluoro-heptane, 1-Chlor-perfluorheptan, 1-chloro-pentadecafluoro-heptane, 1-chloroperfluoroheptane, Chlor-perfluor-heptan. |
| Q: What is the LogP of 1-Chloroperfluoroheptane? |
| A: LogP of 1-Chloroperfluoroheptane is 5.55680. |
| Q: What is the English name of 1-Chloroperfluoroheptane? |
| A: The English name of 1-Chloroperfluoroheptane is 1-Chloroperfluoroheptane. |
| Q: What is the molecular formula of 1-Chloroperfluoroheptane? |
| A: Molecular formula of 1-Chloroperfluoroheptane is C7ClF15. |
| Q: What is the InChIKey of 1-Chloroperfluoroheptane? |
| A: InChIKey of 1-Chloroperfluoroheptane is MAUNZEOOXXBGIT-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-Chloroperfluoroheptane? |
| A: Molecular weight of 1-Chloroperfluoroheptane is 404.50400. |
| Q: What is the CAS number of 1-Chloroperfluoroheptane? |
| A: CAS number of 1-Chloroperfluoroheptane is 375-89-3. |
| Q: What is the SMILES notation of 1-Chloroperfluoroheptane? |
| A: SMILES notation of 1-Chloroperfluoroheptane is FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl. |