ethyl (2Z)-2-chloro-2-[(3-nitrophenyl)hydrazinylidene]acetate structure
|
Common Name | ethyl (2Z)-2-chloro-2-[(3-nitrophenyl)hydrazinylidene]acetate | ||
|---|---|---|---|---|
| CAS Number | 37522-27-3 | Molecular Weight | 271.65700 | |
| Density | 1.414g/cm3 | Boiling Point | 371.364ºC at 760 mmHg | |
| Molecular Formula | C10H10ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.395ºC | |
| Name | ethyl (2Z)-2-chloro-2-[(3-nitrophenyl)hydrazinylidene]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 371.364ºC at 760 mmHg |
| Molecular Formula | C10H10ClN3O4 |
| Molecular Weight | 271.65700 |
| Flash Point | 178.395ºC |
| Exact Mass | 271.03600 |
| PSA | 96.51000 |
| LogP | 2.71830 |
| Index of Refraction | 1.586 |
| InChIKey | SXQJFYKQVJQWCV-LCYFTJDESA-N |
| SMILES | CCOC(=O)C(Cl)=NNc1cccc([N+](=O)[O-])c1 |
|
~%
ethyl (2Z)-2-ch... CAS#:37522-27-3 |
| Literature: Bowack; Lapworth Journal of the Chemical Society, 1905 , vol. 87, p. 1859 |
|
~%
ethyl (2Z)-2-ch... CAS#:37522-27-3 |
| Literature: Shawali, Ahmad S.; Albar, Hassan A. Canadian Journal of Chemistry, 1986 , vol. 64, p. 871 - 875 |
|
~%
ethyl (2Z)-2-ch... CAS#:37522-27-3 |
| Literature: Bernard; Cocco; Maccioni; Plumitallo Farmaco, Edizione Scientifica, 1985 , vol. 40, # 4 p. 259 - 271 |
|
~%
ethyl (2Z)-2-ch... CAS#:37522-27-3 |
| Literature: Bowack; Lapworth Journal of the Chemical Society, 1905 , vol. 87, p. 1859 |
| chloro-(2-cyclohex-3-enyl-ethyl)-dimethyl-silane |
| [2-(3-cyclohexenyl)ethyl]dimethyl chlorosilane |
| Chlor-(2-cyclohex-3-enyl-aethyl)-dimethyl-silan |
| Oxalsaeure-aethylester-[chlorid-(3-nitro-phenylhydrazon)] |
| Chlor-(3-nitro-phenylhydrazono)-essigsaeure-aethylester |
| Chloro[2-(3-cyclohexen-1-yl)ethyl]dimethylsilane |
| chloro-(3-nitro-phenylhydrazono)-acetic acid ethyl ester |
| Dimethylchlorsilylethyl-3-cyclohexen |