methyl 3-[3-[bis[2-(4-methylphenyl)sulfonyloxyethyl]amino]phenyl]propanoate structure
|
Common Name | methyl 3-[3-[bis[2-(4-methylphenyl)sulfonyloxyethyl]amino]phenyl]propanoate | ||
|---|---|---|---|---|
| CAS Number | 3753-41-1 | Molecular Weight | 575.69400 | |
| Density | 1.286g/cm3 | Boiling Point | 724.1ºC at 760 mmHg | |
| Molecular Formula | C28H33NO8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 391.7ºC | |
| Name | methyl 3-[3-[bis[2-(4-methylphenyl)sulfonyloxyethyl]amino]phenyl]propanoate |
|---|
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 724.1ºC at 760 mmHg |
| Molecular Formula | C28H33NO8S2 |
| Molecular Weight | 575.69400 |
| Flash Point | 391.7ºC |
| Exact Mass | 575.16500 |
| PSA | 133.04000 |
| LogP | 6.18800 |
| Index of Refraction | 1.582 |
| InChIKey | LYBCIGKBBYEPCA-UHFFFAOYSA-N |
| SMILES | COC(=O)CCc1cccc(N(CCOS(=O)(=O)c2ccc(C)cc2)CCOS(=O)(=O)c2ccc(C)cc2)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |