Cbz-4'-pyridyl-D-Ala structure
|
Common Name | Cbz-4'-pyridyl-D-Ala | ||
|---|---|---|---|---|
| CAS Number | 37535-54-9 | Molecular Weight | 300.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cbz-4'-pyridyl-D-Ala |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16N2O4 |
|---|---|
| Molecular Weight | 300.31 |
| InChIKey | OZAKUELEMVNARK-CQSZACIVSA-N |
| SMILES | O=C(NC(Cc1ccncc1)C(=O)O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Cbz-4'-pyridyl-D-Ala? |
| A: Molecular formula of Cbz-4'-pyridyl-D-Ala is C16H16N2O4. |
| Q: What is the Chinese name of 37535-54-9? |
| A: Chinese name of 37535-54-9 is 37535-54-9. |
| Q: What is the InChIKey of Cbz-4'-pyridyl-D-Ala? |
| A: InChIKey of Cbz-4'-pyridyl-D-Ala is OZAKUELEMVNARK-CQSZACIVSA-N. |
| Q: What is the molecular weight of Cbz-4'-pyridyl-D-Ala? |
| A: Molecular weight of Cbz-4'-pyridyl-D-Ala is 300.31. |
| Q: What is the CAS number of Cbz-4'-pyridyl-D-Ala? |
| A: CAS number of Cbz-4'-pyridyl-D-Ala is 37535-54-9. |
| Q: What is the SMILES notation of Cbz-4'-pyridyl-D-Ala? |
| A: SMILES notation of Cbz-4'-pyridyl-D-Ala is O=C(NC(Cc1ccncc1)C(=O)O)OCc1ccccc1. |
| Q: What is the English name of Cbz-4'-pyridyl-D-Ala? |
| A: The English name of Cbz-4'-pyridyl-D-Ala is Cbz-4'-pyridyl-D-Ala. |