4,4'-(PROPANE-2,2-DIYL)BIS(VINYLOXYBENZENE) structure
|
Common Name | 4,4'-(PROPANE-2,2-DIYL)BIS(VINYLOXYBENZENE) | ||
|---|---|---|---|---|
| CAS Number | 3754-60-7 | Molecular Weight | 280.36100 | |
| Density | 1.023g/cm3 | Boiling Point | 374.9ºC at 760mmHg | |
| Molecular Formula | C19H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.5ºC | |
| Name | 1,1'-(2,2-Propanediyl)bis[4-(vinyloxy)benzene] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.023g/cm3 |
|---|---|
| Boiling Point | 374.9ºC at 760mmHg |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.36100 |
| Flash Point | 134.5ºC |
| Exact Mass | 280.14600 |
| PSA | 18.46000 |
| LogP | 5.05710 |
| Index of Refraction | 1.544 |
| InChIKey | YOTSWLOWHSUGIM-UHFFFAOYSA-N |
| SMILES | C=COc1ccc(C(C)(C)c2ccc(OC=C)cc2)cc1 |
| HS Code | 2909309090 |
|---|
|
~88%
4,4'-(PROPANE-2... CAS#:3754-60-7 |
| Literature: Okimoto, Yoshio; Sakaguchi, Satoshi; Ishii, Yasutaka Journal of the American Chemical Society, 2002 , vol. 124, # 8 p. 1590 - 1591 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Cyclohexanecarbonitrile,1,1'-iminobis |
| 1,1'-isopropylidenebis[4-(vinyloxy)benzene] |
| 2,2-Bis-(4-hydroxyphenyl)-propan-divinylaether |
| bis(1-cyano-cyclohexyl-1)-amine |
| Bis-<1-cyan-cyclohexyl>-amin |
| 1,1'-Imino-bis-cyclohexancarbonitril |
| bis-(1-cyanocyclohexyl)amine |
| bisphenol-A divinyl ether |
| 2.2-Bis-<4-vinyloxy-phenyl>-propan |
| Bis-(1-cyan-cyclohexyl-(1))-amin |
| 1,1'-imino-bis-cyclohexanecarbonitrile |
| 1.1'-Imino-dicyclohexylnitril |