4-amino-2,7-dichloro-9H-fluoren-9-ol structure
|
Common Name | 4-amino-2,7-dichloro-9H-fluoren-9-ol | ||
|---|---|---|---|---|
| CAS Number | 37558-69-3 | Molecular Weight | 266.12300 | |
| Density | 1.551g/cm3 | Boiling Point | 493.3ºC at 760 mmHg | |
| Molecular Formula | C13H9Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.2ºC | |
| Name | 4-amino-2,7-dichloro-9H-fluoren-9-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.551g/cm3 |
|---|---|
| Boiling Point | 493.3ºC at 760 mmHg |
| Molecular Formula | C13H9Cl2NO |
| Molecular Weight | 266.12300 |
| Flash Point | 252.2ºC |
| Exact Mass | 265.00600 |
| PSA | 46.25000 |
| LogP | 4.21890 |
| Index of Refraction | 1.743 |
| InChIKey | CEUFYXORISZJGP-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)cc2c1-c1ccc(Cl)cc1C2O |
| HS Code | 2922199090 |
|---|
|
~%
4-amino-2,7-dic... CAS#:37558-69-3 |
| Literature: Pan,H.-L.; Fletcher,T.L. Synthesis, 1972 , p. 192 - 194 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms3094i11 |