Methanone, (4-chloro-3-nitrophenyl)(4-nitrophenyl)- structure
|
Common Name | Methanone, (4-chloro-3-nitrophenyl)(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 37567-38-7 | Molecular Weight | 306.65800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-3,4'-dinitro benzophenone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H7ClN2O5 |
|---|---|
| Molecular Weight | 306.65800 |
| Exact Mass | 306.00400 |
| PSA | 108.71000 |
| LogP | 4.43380 |
| InChIKey | JKIBKUVDIOBWEH-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Chlor-3,4'-dinitro-benzophenon |
| (4-Nitro-phenyl)-(4-chlor-3-nitro-phenyl)-keton |
| 4-chloro-3,4'-dinitrobenzophenone |
| 3,4'-dinitro-4-chlorobenzophenone |
| 4-chloro-3,4'-dinitro-benzophenone |