3-Pyrazolin-5-one, 3-chloro-1,2-diphenyl-4-(piperidinomethyl)- structure
|
Common Name | 3-Pyrazolin-5-one, 3-chloro-1,2-diphenyl-4-(piperidinomethyl)- | ||
|---|---|---|---|---|
| CAS Number | 37585-42-5 | Molecular Weight | 367.87200 | |
| Density | 1.31g/cm3 | Boiling Point | 473.8ºC at 760mmHg | |
| Molecular Formula | C21H22ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.3ºC | |
| Name | 5-chloro-1,2-diphenyl-4-(piperidin-1-ylmethyl)pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 473.8ºC at 760mmHg |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.87200 |
| Flash Point | 240.3ºC |
| Exact Mass | 367.14500 |
| PSA | 30.17000 |
| LogP | 4.20540 |
| Index of Refraction | 1.673 |
| InChIKey | BARXHCDTIRFAEV-UHFFFAOYSA-N |
| SMILES | O=c1c(CN2CCCCC2)c(Cl)n(-c2ccccc2)n1-c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Chloro-4-piperidinomethyl-1,2-diphenyl-5-pyrazolone |
| 3-Pyrazolin-5-one,3-chloro-1,2-diphenyl-4-(piperidinomethyl) |
| 3H-Pyrazol-3-one,5-chloro-1,2-dihydro-1,2-diphenyl-4-(1-piperidinylmethyl) |
| 5-chloro-1,2-diphenyl-4-piperidin-1-ylmethyl-1,2-dihydro-pyrazol-3-one |
| 3-Chloro-1,2-diphenyl-4-(piperidinomethyl)-3-pyrazolin-5-one |
| 5-chloro-1,2-diphenyl-4-(piperidin-1-ylmethyl)-1,2-dihydro-3h-pyrazol-3-one |