I+/--[(4-Hydroxyphenyl)methyl]-4-(phenylmethyl)-1-piperidineethanol structure
|
Common Name | I+/--[(4-Hydroxyphenyl)methyl]-4-(phenylmethyl)-1-piperidineethanol | ||
|---|---|---|---|---|
| CAS Number | 375856-68-1 | Molecular Weight | 325.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | I+/--[(4-Hydroxyphenyl)methyl]-4-(phenylmethyl)-1-piperidineethanol |
|---|
| Molecular Formula | C21H27NO2 |
|---|---|
| Molecular Weight | 325.4 |
| InChIKey | LUKRWTWMHQMEIS-UHFFFAOYSA-N |
| SMILES | Oc1ccc(CC(O)CN2CCC(Cc3ccccc3)CC2)cc1 |
|
Name: Selectivity ratio of alpha-1 receptor to that of NMDA was determined
Source: ChEMBL
Target: Alpha-1B adrenergic receptor
External Id: CHEMBL843758
|