GTP-GAMMA-S SODIUM SALT
GTP-GAMMA-S SODIUM SALT structure
|
Common Name | GTP-GAMMA-S SODIUM SALT | ||
|---|---|---|---|---|
| CAS Number | 37589-80-3 | Molecular Weight | 539.25 | |
| Density | 2.68 g/cm3 | Boiling Point | 1014.2ºC at 760 mmHg | |
| Molecular Formula | C10H16N5O13P3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 567.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | guanosine 5'-[γ-thio]triphosphate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.68 g/cm3 |
|---|---|
| Boiling Point | 1014.2ºC at 760 mmHg |
| Molecular Formula | C10H16N5O13P3S |
| Molecular Weight | 539.25 |
| Flash Point | 567.1ºC |
| Exact Mass | 538.96781775 |
| PSA | 354.87000 |
| LogP | 0.76530 |
| InChIKey | XOFLBQFBSOEHOG-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OP(=S)(O)O)O)O)N=C(NC2=O)N |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Experimentally measured binding affinity data (Kd) for protein-ligand complexes deriv...
Source: Shanghai Institute of Organic Chemistry
Target: N/A
External Id: PDBbind-Kd for protein-ligand complexes
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| guanosine 5'-[gamma-thio]triphosphate |
| 5'-Guanylyloxyphosphonyloxythiophosphonic acid |
| Tetrasodium 5'-O-[({[(dioxidophosphorothioyl)oxy]phosphinato}oxy)phosphinato]guanosine |
| Guanosine, 5'-O-[hydroxy[[hydroxy[(hydroxymercaptophosphinyl)oxy]phosphinyl]oxy]phosphinyl]-, sodium salt (1:4) |
| GTP-γ-S SODIUM SALT |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of guanosine 5'-[γ-thio]triphosphate? |
| A: The English name of guanosine 5'-[γ-thio]triphosphate is guanosine 5'-[γ-thio]triphosphate. |
| Q: What is the InChIKey of guanosine 5'-[γ-thio]triphosphate? |
| A: InChIKey of guanosine 5'-[γ-thio]triphosphate is XOFLBQFBSOEHOG-UUOKFMHZSA-N. |
| Q: What is the SMILES notation of guanosine 5'-[γ-thio]triphosphate? |
| A: SMILES notation of guanosine 5'-[γ-thio]triphosphate is C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OP(=S)(O)O)O)O)N=C(NC2=O)N. |
| Q: What is the boiling point of guanosine 5'-[γ-thio]triphosphate? |
| A: Boiling point of guanosine 5'-[γ-thio]triphosphate is 1014.2ºC at 760 mmHg. |
| Q: What English synonyms does guanosine 5'-[γ-thio]triphosphate have? |
| A: English synonyms of guanosine 5'-[γ-thio]triphosphate: guanosine 5'-[gamma-thio]triphosphate, 5'-Guanylyloxyphosphonyloxythiophosphonic acid, Tetrasodium 5'-O-[({[(dioxidophosphorothioyl)oxy]phosphinato}oxy)phosphinato]guanosine, Guanosine, 5'-O-[hydroxy[[hydroxy[(hydroxymercaptophosphinyl)oxy]phosphinyl]oxy]phosphinyl]-, sodium salt (1:4), GTP-γ-S SODIUM SALT. |
| Q: What is the CAS number of guanosine 5'-[γ-thio]triphosphate? |
| A: CAS number of guanosine 5'-[γ-thio]triphosphate is 37589-80-3. |
| Q: What is the polar surface area (PSA) of guanosine 5'-[γ-thio]triphosphate? |
| A: Polar surface area (PSA) of guanosine 5'-[γ-thio]triphosphate is 354.87000. |
| Q: What is the molecular formula of guanosine 5'-[γ-thio]triphosphate? |
| A: Molecular formula of guanosine 5'-[γ-thio]triphosphate is C10H16N5O13P3S. |
| Q: What is the molecular weight of guanosine 5'-[γ-thio]triphosphate? |
| A: Molecular weight of guanosine 5'-[γ-thio]triphosphate is 539.25. |
| Q: What is the Chinese name of 37589-80-3? |
| A: Chinese name of 37589-80-3 is 37589-80-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |