perfluoronon-1-ene structure
|
Common Name | perfluoronon-1-ene | ||
|---|---|---|---|---|
| CAS Number | 376-22-7 | Molecular Weight | 450.06800 | |
| Density | 1.674g/cm3 | Boiling Point | 131.9ºC at 760mmHg | |
| Molecular Formula | C9F18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 42.5ºC | |
| Name | 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-octadecafluoronon-1-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.674g/cm3 |
|---|---|
| Boiling Point | 131.9ºC at 760mmHg |
| Molecular Formula | C9F18 |
| Molecular Weight | 450.06800 |
| Flash Point | 42.5ºC |
| Exact Mass | 449.97100 |
| LogP | 6.43810 |
| Index of Refraction | 1.273 |
| InChIKey | UAFOIVDGAVVKTE-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2903399090 |
|---|
|
~42%
perfluoronon-1-ene CAS#:376-22-7 |
| Literature: Cirkva, Vladimir; Paleta, Oldrich; Ameduri, Bruno; Boutevin, Bernard Journal of Fluorine Chemistry, 1995 , vol. 75, # 1 p. 87 - 92 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| perfluoronon-1-ene |
| Octadecafluor-non-1-en |
| 1-Nonene,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-octadecafluoro |
| octadecafluoro-non-1-ene |
| 1-Nonene,octadecafluoro-(6CI,8CI) |
| EINECS 206-807-6 |
| perfluoro-1-nonene |
| perfluorononene |
| 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Octadecafluoro-1-nonene |