1,2-dichlorooctafluorocyclopentane
1,2-dichlorooctafluorocyclopentane structure
|
Common Name | 1,2-dichlorooctafluorocyclopentane | ||
|---|---|---|---|---|
| CAS Number | 376-75-0 | Molecular Weight | 282.94700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5Cl2F8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-dichlorooctafluorocyclopentane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5Cl2F8 |
|---|---|
| Molecular Weight | 282.94700 |
| Exact Mass | 281.92500 |
| LogP | 3.71510 |
| InChIKey | UMMLBZUMYNNRAK-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(F)(Cl)C(F)(Cl)C1(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2903890090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:559-40-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| cis-1,2-Dichlor-octafluor-cyclopentan |
| 1,2-DICHLOROPERFLUOROCYCLOPENTANE |
| trans-1,2-Dichlor-octafluor-cyclopentan |
| 1,2-dichloroperfluorocyclopentane |
| 1,2 dichlorooctafluorocyclopentane |
| 1,2-dichloro-octafluoro-cyclopentane |
| 1,2-Dichlor-octafluor-cyclopentan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,2-dichlorooctafluorocyclopentane? |
| A: SMILES notation of 1,2-dichlorooctafluorocyclopentane is FC1(F)C(F)(F)C(F)(Cl)C(F)(Cl)C1(F)F. |
| Q: What is the English name of 1,2-dichlorooctafluorocyclopentane? |
| A: The English name of 1,2-dichlorooctafluorocyclopentane is 1,2-dichlorooctafluorocyclopentane. |
| Q: What English synonyms does 1,2-dichlorooctafluorocyclopentane have? |
| A: English synonyms of 1,2-dichlorooctafluorocyclopentane: cis-1,2-Dichlor-octafluor-cyclopentan, 1,2-DICHLOROPERFLUOROCYCLOPENTANE, trans-1,2-Dichlor-octafluor-cyclopentan, 1,2-dichloroperfluorocyclopentane, 1,2 dichlorooctafluorocyclopentane, 1,2-dichloro-octafluoro-cyclopentane, 1,2-Dichlor-octafluor-cyclopentan. |
| Q: What is the LogP of 1,2-dichlorooctafluorocyclopentane? |
| A: LogP of 1,2-dichlorooctafluorocyclopentane is 3.71510. |
| Q: What is the molecular formula of 1,2-dichlorooctafluorocyclopentane? |
| A: Molecular formula of 1,2-dichlorooctafluorocyclopentane is C5Cl2F8. |
| Q: What is the InChIKey of 1,2-dichlorooctafluorocyclopentane? |
| A: InChIKey of 1,2-dichlorooctafluorocyclopentane is UMMLBZUMYNNRAK-UHFFFAOYSA-N. |
| Q: What are the downstream products of 1,2-dichlorooctafluorocyclopentane? |
| A: Related downstream products(CAS) of 1,2-dichlorooctafluorocyclopentane: 559-40-0. |
| Q: What is the molecular weight of 1,2-dichlorooctafluorocyclopentane? |
| A: Molecular weight of 1,2-dichlorooctafluorocyclopentane is 282.94700. |
| Q: What is the CAS number of 1,2-dichlorooctafluorocyclopentane? |
| A: CAS number of 1,2-dichlorooctafluorocyclopentane is 376-75-0. |
| Q: What is the Chinese name of 376-75-0? |
| A: Chinese name of 376-75-0 is 376-75-0. |