decafluorocyclopentane structure
|
Common Name | decafluorocyclopentane | ||
|---|---|---|---|---|
| CAS Number | 376-77-2 | Molecular Weight | 250.03800 | |
| Density | 1.69g/cm3 | Boiling Point | 26.4ºC at 760mmHg | |
| Molecular Formula | C5F10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,2,3,3,4,4,5,5-decafluorocyclopentane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.69g/cm3 |
|---|---|
| Boiling Point | 26.4ºC at 760mmHg |
| Molecular Formula | C5F10 |
| Molecular Weight | 250.03800 |
| Exact Mass | 249.98400 |
| LogP | 3.17650 |
| Index of Refraction | 1.263 |
| InChIKey | PWMJXZJISGDARB-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| HS Code | 2903890090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Cyclopentane,decafluoro |
| F-Cyclopentene |
| methyleneperfluoro-cyclopentane |
| Decafluor-cyclopentan |
| EINECS 206-814-4 |
| perfluorocyclopentane |
| decafluoro-cyclopentane |
| F-Cyclopentane |
| decafluorocyclopentane |