2,5-Bis(2-methyl-2-propanyl)-1H-pyrrole structure
|
Common Name | 2,5-Bis(2-methyl-2-propanyl)-1H-pyrrole | ||
|---|---|---|---|---|
| CAS Number | 3760-56-3 | Molecular Weight | 179.302 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 238.9±9.0 °C at 760 mmHg | |
| Molecular Formula | C12H21N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.3±10.0 °C | |
| Name | 2,5-ditert-butyl-1H-pyrrole |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 238.9±9.0 °C at 760 mmHg |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.302 |
| Flash Point | 94.3±10.0 °C |
| Exact Mass | 179.167404 |
| PSA | 15.79000 |
| LogP | 4.13 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.483 |
| InChIKey | XCHCBBMKEGFANZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)[nH]1 |
| HS Code | 2933990090 |
|---|
|
~99%
2,5-Bis(2-methy... CAS#:3760-56-3 |
| Literature: Veitch, Gemma E.; Bridgwood, Katy L.; Rands-Trevor, Karen; Ley, Steven V. Synlett, 2008 , # 17 p. 2597 - 2600 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrrole, 2,5-bis(1,1-dimethylethyl)- |
| 2,5-di-tert-butylpyrrole |
| 2,5-Di-tert-butyl-1H-pyrrole |
| 2,5-di-t-butylpyrrole |
| 2,5-Bis(2-methyl-2-propanyl)-1H-pyrrole |
| 2,5-bis(tert-butyl)pyrrole |
| 2,5-Di-tert-butylpyrrol |
| 2,4-DICHLORO-6-FORMYLPHENYL BENZOATE |
| 2,5-t-Bu2C4H2NH |