methyl 2-(4-methylbenzamido)benzoate structure
|
Common Name | methyl 2-(4-methylbenzamido)benzoate | ||
|---|---|---|---|---|
| CAS Number | 37619-17-3 | Molecular Weight | 269.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-(4-methylbenzamido)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15NO3 |
|---|---|
| Molecular Weight | 269.29500 |
| Exact Mass | 269.10500 |
| PSA | 55.40000 |
| LogP | 3.10690 |
| InChIKey | QHWGTMUCCXMUOF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccc(C)cc1 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Name: Fluorescence-based counterscreen assay for HCV NS3 helicase inhibitors of a ChemBridg...
Source: 1102
Target: N/A
External Id: 20130627FPNS3INTERFERECB
|
|
Name: Anticoagulant activity assessed as inhibition of arachidonic acid induced rabbit plat...
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL903181
|
|
Name: Anticoagulant activity assessed as inhibition of thrombin induced rabbit platelet agg...
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL903182
|
|
Name: Antiinflammatory activity in neutrophils assessed as inhibition of oxygen radical gen...
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL903183
|
|
Name: Antiinflammatory activity in neutrophil assessed as inhibition of fMLP induced elasta...
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL903184
|
|
Name: Fluorescence polarization based primary biochemical high throughput screening assay o...
Source: 1102
Target: NS3 [Hepatitis C virus]
External Id: 20130624FPNS3DACB
|
|
Name: Cytotoxicity against mouse Melan-a cells assessed as cell viability at 30 uM
Source: ChEMBL
Target: N/A
External Id: CHEMBL1217673
|
|
Name: Depigmentation effect in mouse Melan-a cells assessed as difference between cell viab...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1217672
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
| 2-(4-Methyl-benzamino)-benzoesaeure-methylester |
| N-p-Toluoyl-anthranilsaeure-methylester |
| 2-(4-methyl-benzoylamino)-benzoic acid methyl ester |
| N-p-toluoyl-anthranilic acid methyl ester |
| 4-methyl-2'-methoxycarbonylbenzanilide |